C16H22N2O — CID 82360063
[5-(4-hexylphenyl)-1,3-oxazol-2-yl]methanamine (PubChem CID 82360063) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is [5-(4-hexylphenyl)-1,3-oxazol-2-yl]methanamine.
| Compound Name | [5-(4-hexylphenyl)-1,3-oxazol-2-yl]methanamine |
|---|---|
| PubChem CID | 82360063 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | [5-(4-hexylphenyl)-1,3-oxazol-2-yl]methanamine |
| SMILES | CCCCCCc1ccc(-c2cnc(CN)o2)cc1 |
| InChI | InChI=1S/C16H22N2O/c1-2-3-4-5-6-13-7-9-14(10-8-13)15-12-18-16(11-17)19-15/h7-10,12H,2-6,11,17H2,1H3 |
| InChIKey | LNFGTHMAFNHAIP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|