C16H18N2O3 — CID 82361985
1-(2,3-dimethylphenyl)-5-(oxolan-2-yl)pyrazole-3-carboxylic acid (PubChem CID 82361985) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-5-(oxolan-2-yl)pyrazole-3-carboxylic acid.
| Compound Name | 1-(2,3-dimethylphenyl)-5-(oxolan-2-yl)pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 82361985 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-5-(oxolan-2-yl)pyrazole-3-carboxylic acid |
| SMILES | Cc1cccc(-n2nc(C(=O)O)cc2C2CCCO2)c1C |
| InChI | InChI=1S/C16H18N2O3/c1-10-5-3-6-13(11(10)2)18-14(15-7-4-8-21-15)9-12(17-18)16(19)20/h3,5-6,9,15H,4,7-8H2,1-2H3,(H,19,20) |
| InChIKey | DNJPFWSSNAWZGW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |