About 4-(3,4-difluorophenyl)-5-methyl-3H-1,3-thiazole-2-thione
4-(3,4-difluorophenyl)-5-methyl-3H-1,3-thiazole-2-thione (PubChem CID 82362773) has the molecular formula C10H7F2NS2
and a molecular weight of 243.30 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-5-methyl-3H-1,3-thiazole-2-thione.
Molecular Properties
| Compound Name | 4-(3,4-difluorophenyl)-5-methyl-3H-1,3-thiazole-2-thione |
| PubChem CID | 82362773 |
| Molecular Formula | C10H7F2NS2 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.00 |
| IUPAC Name | 4-(3,4-difluorophenyl)-5-methyl-3H-1,3-thiazole-2-thione |
| SMILES | Cc1sc(=S)[nH]c1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H7F2NS2/c1-5-9(13-10(14)15-5)6-2-3-7(11)8(12)4-6/h2-4H,1H3,(H,13,14) |
| InChIKey | JEOIRPZEIDSWJQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,4-difluorophenyl)-5-methyl-3H-1,3-thiazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-difluorophenyl)-5-methyl-3H-1,3-thiazole-2-thione?
The IUPAC name of 4-(3,4-difluorophenyl)-5-methyl-3H-1,3-thiazole-2-thione (CID 82362773) is 4-(3,4-difluorophenyl)-5-methyl-3H-1,3-thiazole-2-thione.
What is the SMILES notation for 4-(3,4-difluorophenyl)-5-methyl-3H-1,3-thiazole-2-thione?
The canonical SMILES for 4-(3,4-difluorophenyl)-5-methyl-3H-1,3-thiazole-2-thione is Cc1sc(=S)[nH]c1-c1ccc(F)c(F)c1.
What is the InChIKey of 4-(3,4-difluorophenyl)-5-methyl-3H-1,3-thiazole-2-thione?
The InChIKey is JEOIRPZEIDSWJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F2NS2/c1-5-9(13-10(14)15-5)6-2-3-7(11)8(12)4-6/h2-4H,1H3,(H,13,14).
What are the key properties of 4-(3,4-difluorophenyl)-5-methyl-3H-1,3-thiazole-2-thione?
4-(3,4-difluorophenyl)-5-methyl-3H-1,3-thiazole-2-thione has a molecular weight of 243.30 g/mol, XLogP of 4.06, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-difluorophenyl)-5-methyl-3H-1,3-thiazole-2-thione is sourced from PubChem (CID 82362773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).