About 3-(2-fluorophenyl)-1,2-oxazole-4-carbaldehyde
3-(2-fluorophenyl)-1,2-oxazole-4-carbaldehyde (PubChem CID 82362916) has the molecular formula C10H6FNO2
and a molecular weight of 191.16 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-1,2-oxazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 3-(2-fluorophenyl)-1,2-oxazole-4-carbaldehyde |
| PubChem CID | 82362916 |
| Molecular Formula | C10H6FNO2 |
| Molecular Weight | 191.16 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | 3-(2-fluorophenyl)-1,2-oxazole-4-carbaldehyde |
| SMILES | O=Cc1conc1-c1ccccc1F |
| InChI | InChI=1S/C10H6FNO2/c11-9-4-2-1-3-8(9)10-7(5-13)6-14-12-10/h1-6H |
| InChIKey | CEAAGBMQTUMDNP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.16 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-fluorophenyl)-1,2-oxazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-fluorophenyl)-1,2-oxazole-4-carbaldehyde?
The IUPAC name of 3-(2-fluorophenyl)-1,2-oxazole-4-carbaldehyde (CID 82362916) is 3-(2-fluorophenyl)-1,2-oxazole-4-carbaldehyde.
What is the SMILES notation for 3-(2-fluorophenyl)-1,2-oxazole-4-carbaldehyde?
The canonical SMILES for 3-(2-fluorophenyl)-1,2-oxazole-4-carbaldehyde is O=Cc1conc1-c1ccccc1F.
What is the InChIKey of 3-(2-fluorophenyl)-1,2-oxazole-4-carbaldehyde?
The InChIKey is CEAAGBMQTUMDNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6FNO2/c11-9-4-2-1-3-8(9)10-7(5-13)6-14-12-10/h1-6H.
What are the key properties of 3-(2-fluorophenyl)-1,2-oxazole-4-carbaldehyde?
3-(2-fluorophenyl)-1,2-oxazole-4-carbaldehyde has a molecular weight of 191.16 g/mol, XLogP of 2.29, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-fluorophenyl)-1,2-oxazole-4-carbaldehyde is sourced from PubChem (CID 82362916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).