C15H21N3O — CID 82363813
2,2,6-trimethyl-3-piperazin-1-yl-1,4-benzoxazine (PubChem CID 82363813) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 2,2,6-trimethyl-3-piperazin-1-yl-1,4-benzoxazine.
| Compound Name | 2,2,6-trimethyl-3-piperazin-1-yl-1,4-benzoxazine |
|---|---|
| PubChem CID | 82363813 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 2,2,6-trimethyl-3-piperazin-1-yl-1,4-benzoxazine |
| SMILES | Cc1ccc2c(c1)N=C(N1CCNCC1)C(C)(C)O2 |
| InChI | InChI=1S/C15H21N3O/c1-11-4-5-13-12(10-11)17-14(15(2,3)19-13)18-8-6-16-7-9-18/h4-5,10,16H,6-9H2,1-3H3 |
| InChIKey | SCTBOOCFHWVSEQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |