C13H18N2 — CID 82364120
4-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]aniline (PubChem CID 82364120) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 4-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]aniline.
| Compound Name | 4-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]aniline |
|---|---|
| PubChem CID | 82364120 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 4-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]aniline |
| SMILES | CC1=CCN(Cc2ccc(N)cc2)CC1 |
| InChI | InChI=1S/C13H18N2/c1-11-6-8-15(9-7-11)10-12-2-4-13(14)5-3-12/h2-6H,7-10,14H2,1H3 |
| InChIKey | DWNIAUCGTCUUNW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|