C10H12ClN3O2S — CID 82364475
3-[(6-chloro-3-methylimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]propanoic acid (PubChem CID 82364475) has the molecular formula C10H12ClN3O2S and a molecular weight of 273.75 g/mol. Its IUPAC name is 3-[(6-chloro-3-methylimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]propanoic acid.
| Compound Name | 3-[(6-chloro-3-methylimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]propanoic acid |
|---|---|
| PubChem CID | 82364475 |
| Molecular Formula | C10H12ClN3O2S |
| Molecular Weight | 273.75 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 3-[(6-chloro-3-methylimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]propanoic acid |
| SMILES | Cc1csc2nc(Cl)c(CNCCC(=O)O)n12 |
| InChI | InChI=1S/C10H12ClN3O2S/c1-6-5-17-10-13-9(11)7(14(6)10)4-12-3-2-8(15)16/h5,12H,2-4H2,1H3,(H,15,16) |
| InChIKey | XYKYACPHJKFPIO-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.75 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|