C11H12Cl2N2O3 — CID 82364686
2-[[2-[(2,3-dichlorophenyl)methylamino]acetyl]amino]acetic acid (PubChem CID 82364686) has the molecular formula C11H12Cl2N2O3 and a molecular weight of 291.13 g/mol. Its IUPAC name is 2-[[2-[(2,3-dichlorophenyl)methylamino]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[(2,3-dichlorophenyl)methylamino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 82364686 |
| Molecular Formula | C11H12Cl2N2O3 |
| Molecular Weight | 291.13 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 2-[[2-[(2,3-dichlorophenyl)methylamino]acetyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)CNCc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C11H12Cl2N2O3/c12-8-3-1-2-7(11(8)13)4-14-5-9(16)15-6-10(17)18/h1-3,14H,4-6H2,(H,15,16)(H,17,18) |
| InChIKey | JEVLLFDEBIGQAN-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.13 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |