About 1-(methoxymethyl)-5-(2H-tetrazol-5-yl)-3,6-dihydro-2H-pyridine
1-(methoxymethyl)-5-(2H-tetrazol-5-yl)-3,6-dihydro-2H-pyridine (PubChem CID 82365250) has the molecular formula C8H13N5O
and a molecular weight of 195.23 g/mol. Its IUPAC name is 1-(methoxymethyl)-5-(2H-tetrazol-5-yl)-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 1-(methoxymethyl)-5-(2H-tetrazol-5-yl)-3,6-dihydro-2H-pyridine |
| PubChem CID | 82365250 |
| Molecular Formula | C8H13N5O |
| Molecular Weight | 195.23 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 1-(methoxymethyl)-5-(2H-tetrazol-5-yl)-3,6-dihydro-2H-pyridine |
| SMILES | COCN1CCC=C(c2nn[nH]n2)C1 |
| InChI | InChI=1S/C8H13N5O/c1-14-6-13-4-2-3-7(5-13)8-9-11-12-10-8/h3H,2,4-6H2,1H3,(H,9,10,11,12) |
| InChIKey | WJNCJMVPCMMCRZ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.23 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(methoxymethyl)-5-(2H-tetrazol-5-yl)-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(methoxymethyl)-5-(2H-tetrazol-5-yl)-3,6-dihydro-2H-pyridine?
The IUPAC name of 1-(methoxymethyl)-5-(2H-tetrazol-5-yl)-3,6-dihydro-2H-pyridine (CID 82365250) is 1-(methoxymethyl)-5-(2H-tetrazol-5-yl)-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 1-(methoxymethyl)-5-(2H-tetrazol-5-yl)-3,6-dihydro-2H-pyridine?
The canonical SMILES for 1-(methoxymethyl)-5-(2H-tetrazol-5-yl)-3,6-dihydro-2H-pyridine is COCN1CCC=C(c2nn[nH]n2)C1.
What is the InChIKey of 1-(methoxymethyl)-5-(2H-tetrazol-5-yl)-3,6-dihydro-2H-pyridine?
The InChIKey is WJNCJMVPCMMCRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N5O/c1-14-6-13-4-2-3-7(5-13)8-9-11-12-10-8/h3H,2,4-6H2,1H3,(H,9,10,11,12).
What are the key properties of 1-(methoxymethyl)-5-(2H-tetrazol-5-yl)-3,6-dihydro-2H-pyridine?
1-(methoxymethyl)-5-(2H-tetrazol-5-yl)-3,6-dihydro-2H-pyridine has a molecular weight of 195.23 g/mol, XLogP of -0.11, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(methoxymethyl)-5-(2H-tetrazol-5-yl)-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 82365250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).