C11H9N3O5 — CID 82365367
5-amino-1-(3-carboxy-4-hydroxyphenyl)pyrazole-4-carboxylic acid (PubChem CID 82365367) has the molecular formula C11H9N3O5 and a molecular weight of 263.21 g/mol. Its IUPAC name is 5-amino-1-(3-carboxy-4-hydroxyphenyl)pyrazole-4-carboxylic acid.
| Compound Name | 5-amino-1-(3-carboxy-4-hydroxyphenyl)pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82365367 |
| Molecular Formula | C11H9N3O5 |
| Molecular Weight | 263.21 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 5-amino-1-(3-carboxy-4-hydroxyphenyl)pyrazole-4-carboxylic acid |
| SMILES | Nc1c(C(=O)O)cnn1-c1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H9N3O5/c12-9-7(11(18)19)4-13-14(9)5-1-2-8(15)6(3-5)10(16)17/h1-4,15H,12H2,(H,16,17)(H,18,19) |
| InChIKey | OQDPVHIFPIFLCS-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.21 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |