C10H6Cl2N4O2 — CID 82366486
(E)-3-[1-(3,4-dichlorophenyl)tetrazol-5-yl]prop-2-enoic acid (PubChem CID 82366486) has the molecular formula C10H6Cl2N4O2 and a molecular weight of 285.09 g/mol. Its IUPAC name is (E)-3-[1-(3,4-dichlorophenyl)tetrazol-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[1-(3,4-dichlorophenyl)tetrazol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 82366486 |
| Molecular Formula | C10H6Cl2N4O2 |
| Molecular Weight | 285.09 g/mol |
| Exact Mass | 283.99 |
| IUPAC Name | (E)-3-[1-(3,4-dichlorophenyl)tetrazol-5-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1nnnn1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H6Cl2N4O2/c11-7-2-1-6(5-8(7)12)16-9(13-14-15-16)3-4-10(17)18/h1-5H,(H,17,18)/b4-3+ |
| InChIKey | LYAPWBRLUHFZAP-ONEGZZNKSA-N |
| XLogP | 2.07 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.09 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|