C14H14N2O2S — CID 82367452
6-(2-methoxy-5-methylphenyl)-2,3-dihydroimidazo[2,1-b][1,3]thiazole-5-carbaldehyde (PubChem CID 82367452) has the molecular formula C14H14N2O2S and a molecular weight of 274.35 g/mol. Its IUPAC name is 6-(2-methoxy-5-methylphenyl)-2,3-dihydroimidazo[2,1-b][1,3]thiazole-5-carbaldehyde.
| Compound Name | 6-(2-methoxy-5-methylphenyl)-2,3-dihydroimidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 82367452 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 6-(2-methoxy-5-methylphenyl)-2,3-dihydroimidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
| SMILES | COc1ccc(C)cc1-c1nc2n(c1C=O)CCS2 |
| InChI | InChI=1S/C14H14N2O2S/c1-9-3-4-12(18-2)10(7-9)13-11(8-17)16-5-6-19-14(16)15-13/h3-4,7-8H,5-6H2,1-2H3 |
| InChIKey | YHVZPGNUCKBKJZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|