About 1-(7-amino-2-methyl-2H-1,4-benzoxazin-3-yl)piperidine-4-carboxamide
1-(7-amino-2-methyl-2H-1,4-benzoxazin-3-yl)piperidine-4-carboxamide (PubChem CID 82368002) has the molecular formula C15H20N4O2
and a molecular weight of 288.35 g/mol. Its IUPAC name is 1-(7-amino-2-methyl-2H-1,4-benzoxazin-3-yl)piperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-(7-amino-2-methyl-2H-1,4-benzoxazin-3-yl)piperidine-4-carboxamide |
| PubChem CID | 82368002 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 1-(7-amino-2-methyl-2H-1,4-benzoxazin-3-yl)piperidine-4-carboxamide |
| SMILES | CC1Oc2cc(N)ccc2N=C1N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C15H20N4O2/c1-9-15(19-6-4-10(5-7-19)14(17)20)18-12-3-2-11(16)8-13(12)21-9/h2-3,8-10H,4-7,16H2,1H3,(H2,17,20) |
| InChIKey | FWIDOVDGRWOFEO-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-(7-amino-2-methyl-2H-1,4-benzoxazin-3-yl)piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7-amino-2-methyl-2H-1,4-benzoxazin-3-yl)piperidine-4-carboxamide?
The IUPAC name of 1-(7-amino-2-methyl-2H-1,4-benzoxazin-3-yl)piperidine-4-carboxamide (CID 82368002) is 1-(7-amino-2-methyl-2H-1,4-benzoxazin-3-yl)piperidine-4-carboxamide.
What is the SMILES notation for 1-(7-amino-2-methyl-2H-1,4-benzoxazin-3-yl)piperidine-4-carboxamide?
The canonical SMILES for 1-(7-amino-2-methyl-2H-1,4-benzoxazin-3-yl)piperidine-4-carboxamide is CC1Oc2cc(N)ccc2N=C1N1CCC(C(N)=O)CC1.
What is the InChIKey of 1-(7-amino-2-methyl-2H-1,4-benzoxazin-3-yl)piperidine-4-carboxamide?
The InChIKey is FWIDOVDGRWOFEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4O2/c1-9-15(19-6-4-10(5-7-19)14(17)20)18-12-3-2-11(16)8-13(12)21-9/h2-3,8-10H,4-7,16H2,1H3,(H2,17,20).
What are the key properties of 1-(7-amino-2-methyl-2H-1,4-benzoxazin-3-yl)piperidine-4-carboxamide?
1-(7-amino-2-methyl-2H-1,4-benzoxazin-3-yl)piperidine-4-carboxamide has a molecular weight of 288.35 g/mol, XLogP of 1.28, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7-amino-2-methyl-2H-1,4-benzoxazin-3-yl)piperidine-4-carboxamide is sourced from PubChem (CID 82368002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).