About 3-(2,6-dimethylpiperidin-1-yl)-2-ethyl-2H-1,4-benzoxazin-6-amine
3-(2,6-dimethylpiperidin-1-yl)-2-ethyl-2H-1,4-benzoxazin-6-amine (PubChem CID 82368130) has the molecular formula C17H25N3O
and a molecular weight of 287.41 g/mol. Its IUPAC name is 3-(2,6-dimethylpiperidin-1-yl)-2-ethyl-2H-1,4-benzoxazin-6-amine.
Molecular Properties
| Compound Name | 3-(2,6-dimethylpiperidin-1-yl)-2-ethyl-2H-1,4-benzoxazin-6-amine |
| PubChem CID | 82368130 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 3-(2,6-dimethylpiperidin-1-yl)-2-ethyl-2H-1,4-benzoxazin-6-amine |
| SMILES | CCC1Oc2ccc(N)cc2N=C1N1C(C)CCCC1C |
| InChI | InChI=1S/C17H25N3O/c1-4-15-17(20-11(2)6-5-7-12(20)3)19-14-10-13(18)8-9-16(14)21-15/h8-12,15H,4-7,18H2,1-3H3 |
| InChIKey | ABHBYVULZXGUEM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,6-dimethylpiperidin-1-yl)-2-ethyl-2H-1,4-benzoxazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,6-dimethylpiperidin-1-yl)-2-ethyl-2H-1,4-benzoxazin-6-amine?
The IUPAC name of 3-(2,6-dimethylpiperidin-1-yl)-2-ethyl-2H-1,4-benzoxazin-6-amine (CID 82368130) is 3-(2,6-dimethylpiperidin-1-yl)-2-ethyl-2H-1,4-benzoxazin-6-amine.
What is the SMILES notation for 3-(2,6-dimethylpiperidin-1-yl)-2-ethyl-2H-1,4-benzoxazin-6-amine?
The canonical SMILES for 3-(2,6-dimethylpiperidin-1-yl)-2-ethyl-2H-1,4-benzoxazin-6-amine is CCC1Oc2ccc(N)cc2N=C1N1C(C)CCCC1C.
What is the InChIKey of 3-(2,6-dimethylpiperidin-1-yl)-2-ethyl-2H-1,4-benzoxazin-6-amine?
The InChIKey is ABHBYVULZXGUEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N3O/c1-4-15-17(20-11(2)6-5-7-12(20)3)19-14-10-13(18)8-9-16(14)21-15/h8-12,15H,4-7,18H2,1-3H3.
What are the key properties of 3-(2,6-dimethylpiperidin-1-yl)-2-ethyl-2H-1,4-benzoxazin-6-amine?
3-(2,6-dimethylpiperidin-1-yl)-2-ethyl-2H-1,4-benzoxazin-6-amine has a molecular weight of 287.41 g/mol, XLogP of 3.73, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-dimethylpiperidin-1-yl)-2-ethyl-2H-1,4-benzoxazin-6-amine is sourced from PubChem (CID 82368130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).