C16H25N3O — CID 82368152
2-ethyl-3-N,3-N-dipropyl-2H-1,4-benzoxazine-3,7-diamine (PubChem CID 82368152) has the molecular formula C16H25N3O and a molecular weight of 275.40 g/mol. Its IUPAC name is 2-ethyl-3-N,3-N-dipropyl-2H-1,4-benzoxazine-3,7-diamine.
| Compound Name | 2-ethyl-3-N,3-N-dipropyl-2H-1,4-benzoxazine-3,7-diamine |
|---|---|
| PubChem CID | 82368152 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | 2-ethyl-3-N,3-N-dipropyl-2H-1,4-benzoxazine-3,7-diamine |
| SMILES | CCCN(CCC)C1=Nc2ccc(N)cc2OC1CC |
| InChI | InChI=1S/C16H25N3O/c1-4-9-19(10-5-2)16-14(6-3)20-15-11-12(17)7-8-13(15)18-16/h7-8,11,14H,4-6,9-10,17H2,1-3H3 |
| InChIKey | SKWFORGXNQAVQU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|