C14H19N3O — CID 82368208
3-(3-methylpiperidin-1-yl)-2H-1,4-benzoxazin-7-amine (PubChem CID 82368208) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 3-(3-methylpiperidin-1-yl)-2H-1,4-benzoxazin-7-amine.
| Compound Name | 3-(3-methylpiperidin-1-yl)-2H-1,4-benzoxazin-7-amine |
|---|---|
| PubChem CID | 82368208 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 3-(3-methylpiperidin-1-yl)-2H-1,4-benzoxazin-7-amine |
| SMILES | CC1CCCN(C2=Nc3ccc(N)cc3OC2)C1 |
| InChI | InChI=1S/C14H19N3O/c1-10-3-2-6-17(8-10)14-9-18-13-7-11(15)4-5-12(13)16-14/h4-5,7,10H,2-3,6,8-9,15H2,1H3 |
| InChIKey | BXFIMCALSYFTJO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|