C10H13N3O — CID 82368226
3-N,3-N-dimethyl-2H-1,4-benzoxazine-3,7-diamine (PubChem CID 82368226) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is 3-N,3-N-dimethyl-2H-1,4-benzoxazine-3,7-diamine.
| Compound Name | 3-N,3-N-dimethyl-2H-1,4-benzoxazine-3,7-diamine |
|---|---|
| PubChem CID | 82368226 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 3-N,3-N-dimethyl-2H-1,4-benzoxazine-3,7-diamine |
| SMILES | CN(C)C1=Nc2ccc(N)cc2OC1 |
| InChI | InChI=1S/C10H13N3O/c1-13(2)10-6-14-9-5-7(11)3-4-8(9)12-10/h3-5H,6,11H2,1-2H3 |
| InChIKey | LWXNLGXPOYPWFM-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|