About 2-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylic acid
2-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylic acid (PubChem CID 82369315) has the molecular formula C10H8FNO3
and a molecular weight of 209.18 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylic acid.
Analyze 2-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylic acid?
The IUPAC name of 2-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylic acid (CID 82369315) is 2-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylic acid.
What is the SMILES notation for 2-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylic acid?
The canonical SMILES for 2-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylic acid is O=C(O)C1COC(c2ccc(F)cc2)=N1.
What is the InChIKey of 2-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylic acid?
The InChIKey is IKUBNLCQRHUPQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8FNO3/c11-7-3-1-6(2-4-7)9-12-8(5-15-9)10(13)14/h1-4,8H,5H2,(H,13,14).
What are the key properties of 2-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylic acid?
2-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylic acid has a molecular weight of 209.18 g/mol, XLogP of 1.06, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylic acid is sourced from PubChem (CID 82369315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).