3-[1-(2-ethylphenyl)triazol-4-yl]propanoic acid

C13H15N3O2 — CID 82369387

IUPAC3-[1-(2-ethylphenyl)triazol-4-yl]propanoic acid
SMILESCCc1ccccc1-n1cc(CCC(=O)O)nn1
InChIInChI=1S/C13H15N3O2/c1-2-10-5-3-4-6-12(10)16-9-11(14-15-16)7-8-13(17)18/h3-6,9H,2,7-8H2,1H3,(H,17,18)
InChIKeyBWIRKWGIWTUINL-UHFFFAOYSA-N
MW245.28 g/mol
LogP1.85
Rot. Bonds5

About 3-[1-(2-ethylphenyl)triazol-4-yl]propanoic acid

3-[1-(2-ethylphenyl)triazol-4-yl]propanoic acid (PubChem CID 82369387) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 3-[1-(2-ethylphenyl)triazol-4-yl]propanoic acid.

Molecular Properties

Compound Name3-[1-(2-ethylphenyl)triazol-4-yl]propanoic acid
PubChem CID82369387
Molecular FormulaC13H15N3O2
Molecular Weight245.28 g/mol
Exact Mass245.12
IUPAC Name3-[1-(2-ethylphenyl)triazol-4-yl]propanoic acid
SMILESCCc1ccccc1-n1cc(CCC(=O)O)nn1
InChIInChI=1S/C13H15N3O2/c1-2-10-5-3-4-6-12(10)16-9-11(14-15-16)7-8-13(17)18/h3-6,9H,2,7-8H2,1H3,(H,17,18)
InChIKeyBWIRKWGIWTUINL-UHFFFAOYSA-N
XLogP1.85
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.28
LogP ≤ 51.85
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-[1-(2-ethylphenyl)triazol-4-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-(1-benzyl-1H-1,2,3-triazol-4-yl)acetic acid
CID 24752099
9-[1-(4-Methylphenyl)triazol-4-yl]nonanoic acid
CID 24816473
3-(1-phenyl-1H-1,2,3-triazol-4-yl)propanoic acid
CID 15619013
3-[1-(3-Fluorophenyl)triazol-4-yl]propanoic acid
CID 12461556
3-[1-(3-Chlorophenyl)triazol-4-yl]propanoic acid
CID 12461557
(2S)-2-amino-3-(1-benzyltriazol-4-yl)propanoic acid
CID 15060245
3-[1-[2-(Benzylamino)-2-oxoethyl]triazol-4-yl]propanoic acid
CID 107461035
1-(2-ethylphenyl)-1H-1,2,3-triazole-4-carboxylic acid
CID 28743174
2-(1-phenyl-1H-1,2,3-triazol-4-yl)acetic acid
CID 83638124
{1-[3-(trifluoromethyl)phenyl]-1H-1,2,3-triazol-5-yl}acetic acid
CID 24278271
Dimethyl 2-(1-phenyltriazol-4-yl)butanedioate
CID 15619010
Ethyl 3-(1-phenyltriazol-4-yl)propanoate
CID 15619011

Frequently Asked Questions

What is the IUPAC name of 3-[1-(2-ethylphenyl)triazol-4-yl]propanoic acid?
The IUPAC name of 3-[1-(2-ethylphenyl)triazol-4-yl]propanoic acid (CID 82369387) is 3-[1-(2-ethylphenyl)triazol-4-yl]propanoic acid.
What is the SMILES notation for 3-[1-(2-ethylphenyl)triazol-4-yl]propanoic acid?
The canonical SMILES for 3-[1-(2-ethylphenyl)triazol-4-yl]propanoic acid is CCc1ccccc1-n1cc(CCC(=O)O)nn1.
What is the InChIKey of 3-[1-(2-ethylphenyl)triazol-4-yl]propanoic acid?
The InChIKey is BWIRKWGIWTUINL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O2/c1-2-10-5-3-4-6-12(10)16-9-11(14-15-16)7-8-13(17)18/h3-6,9H,2,7-8H2,1H3,(H,17,18).
What are the key properties of 3-[1-(2-ethylphenyl)triazol-4-yl]propanoic acid?
3-[1-(2-ethylphenyl)triazol-4-yl]propanoic acid has a molecular weight of 245.28 g/mol, XLogP of 1.85, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(2-ethylphenyl)triazol-4-yl]propanoic acid is sourced from PubChem (CID 82369387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).