C15H12F2N4 — CID 82369881
3-[4-(2,5-difluorophenyl)triazol-1-yl]-4-methylaniline (PubChem CID 82369881) has the molecular formula C15H12F2N4 and a molecular weight of 286.29 g/mol. Its IUPAC name is 3-[4-(2,5-difluorophenyl)triazol-1-yl]-4-methylaniline.
| Compound Name | 3-[4-(2,5-difluorophenyl)triazol-1-yl]-4-methylaniline |
|---|---|
| PubChem CID | 82369881 |
| Molecular Formula | C15H12F2N4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 3-[4-(2,5-difluorophenyl)triazol-1-yl]-4-methylaniline |
| SMILES | Cc1ccc(N)cc1-n1cc(-c2cc(F)ccc2F)nn1 |
| InChI | InChI=1S/C15H12F2N4/c1-9-2-4-11(18)7-15(9)21-8-14(19-20-21)12-6-10(16)3-5-13(12)17/h2-8H,18H2,1H3 |
| InChIKey | NDZURJXVXWPLQH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|