About 2-[5-amino-4-(3,4-dimethylphenyl)triazol-1-yl]benzonitrile
2-[5-amino-4-(3,4-dimethylphenyl)triazol-1-yl]benzonitrile (PubChem CID 82370409) has the molecular formula C17H15N5
and a molecular weight of 289.34 g/mol. Its IUPAC name is 2-[5-amino-4-(3,4-dimethylphenyl)triazol-1-yl]benzonitrile.
Molecular Properties
| Compound Name | 2-[5-amino-4-(3,4-dimethylphenyl)triazol-1-yl]benzonitrile |
| PubChem CID | 82370409 |
| Molecular Formula | C17H15N5 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2-[5-amino-4-(3,4-dimethylphenyl)triazol-1-yl]benzonitrile |
| SMILES | Cc1ccc(-c2nnn(-c3ccccc3C#N)c2N)cc1C |
| InChI | InChI=1S/C17H15N5/c1-11-7-8-13(9-12(11)2)16-17(19)22(21-20-16)15-6-4-3-5-14(15)10-18/h3-9H,19H2,1-2H3 |
| InChIKey | RWQXYXCIZAMUSL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 80.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[5-amino-4-(3,4-dimethylphenyl)triazol-1-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-amino-4-(3,4-dimethylphenyl)triazol-1-yl]benzonitrile?
The IUPAC name of 2-[5-amino-4-(3,4-dimethylphenyl)triazol-1-yl]benzonitrile (CID 82370409) is 2-[5-amino-4-(3,4-dimethylphenyl)triazol-1-yl]benzonitrile.
What is the SMILES notation for 2-[5-amino-4-(3,4-dimethylphenyl)triazol-1-yl]benzonitrile?
The canonical SMILES for 2-[5-amino-4-(3,4-dimethylphenyl)triazol-1-yl]benzonitrile is Cc1ccc(-c2nnn(-c3ccccc3C#N)c2N)cc1C.
What is the InChIKey of 2-[5-amino-4-(3,4-dimethylphenyl)triazol-1-yl]benzonitrile?
The InChIKey is RWQXYXCIZAMUSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N5/c1-11-7-8-13(9-12(11)2)16-17(19)22(21-20-16)15-6-4-3-5-14(15)10-18/h3-9H,19H2,1-2H3.
What are the key properties of 2-[5-amino-4-(3,4-dimethylphenyl)triazol-1-yl]benzonitrile?
2-[5-amino-4-(3,4-dimethylphenyl)triazol-1-yl]benzonitrile has a molecular weight of 289.34 g/mol, XLogP of 3.01, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-amino-4-(3,4-dimethylphenyl)triazol-1-yl]benzonitrile is sourced from PubChem (CID 82370409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).