C15H12F2N4O — CID 82370673
5-(2,5-difluorophenyl)-3-(2-methoxyphenyl)triazol-4-amine (PubChem CID 82370673) has the molecular formula C15H12F2N4O and a molecular weight of 302.28 g/mol. Its IUPAC name is 5-(2,5-difluorophenyl)-3-(2-methoxyphenyl)triazol-4-amine.
| Compound Name | 5-(2,5-difluorophenyl)-3-(2-methoxyphenyl)triazol-4-amine |
|---|---|
| PubChem CID | 82370673 |
| Molecular Formula | C15H12F2N4O |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 5-(2,5-difluorophenyl)-3-(2-methoxyphenyl)triazol-4-amine |
| SMILES | COc1ccccc1-n1nnc(-c2cc(F)ccc2F)c1N |
| InChI | InChI=1S/C15H12F2N4O/c1-22-13-5-3-2-4-12(13)21-15(18)14(19-20-21)10-8-9(16)6-7-11(10)17/h2-8H,18H2,1H3 |
| InChIKey | YQIZQKQWKOYBEM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |