3-(2,5-difluorophenyl)-1-phenylpyrazole-5-carboxylic acid

C16H10F2N2O2 — CID 82370998

IUPAC3-(2,5-difluorophenyl)-1-phenylpyrazole-5-carboxylic acid
SMILESO=C(O)c1cc(-c2cc(F)ccc2F)nn1-c1ccccc1
InChIInChI=1S/C16H10F2N2O2/c17-10-6-7-13(18)12(8-10)14-9-15(16(21)22)20(19-14)11-4-2-1-3-5-11/h1-9H,(H,21,22)
InChIKeyWJJXURSXCSOYPN-UHFFFAOYSA-N
MW300.26 g/mol
LogP3.52
Rot. Bonds3

About 3-(2,5-difluorophenyl)-1-phenylpyrazole-5-carboxylic acid

3-(2,5-difluorophenyl)-1-phenylpyrazole-5-carboxylic acid (PubChem CID 82370998) has the molecular formula C16H10F2N2O2 and a molecular weight of 300.26 g/mol. Its IUPAC name is 3-(2,5-difluorophenyl)-1-phenylpyrazole-5-carboxylic acid.

Molecular Properties

Compound Name3-(2,5-difluorophenyl)-1-phenylpyrazole-5-carboxylic acid
PubChem CID82370998
Molecular FormulaC16H10F2N2O2
Molecular Weight300.26 g/mol
Exact Mass300.07
IUPAC Name3-(2,5-difluorophenyl)-1-phenylpyrazole-5-carboxylic acid
SMILESO=C(O)c1cc(-c2cc(F)ccc2F)nn1-c1ccccc1
InChIInChI=1S/C16H10F2N2O2/c17-10-6-7-13(18)12(8-10)14-9-15(16(21)22)20(19-14)11-4-2-1-3-5-11/h1-9H,(H,21,22)
InChIKeyWJJXURSXCSOYPN-UHFFFAOYSA-N
XLogP3.52
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500300.26
LogP ≤ 53.52
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(2,5-difluorophenyl)-1-phenylpyrazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,5-difluorophenyl)-1-phenylpyrazole-5-carboxylic acid?
The IUPAC name of 3-(2,5-difluorophenyl)-1-phenylpyrazole-5-carboxylic acid (CID 82370998) is 3-(2,5-difluorophenyl)-1-phenylpyrazole-5-carboxylic acid.
What is the SMILES notation for 3-(2,5-difluorophenyl)-1-phenylpyrazole-5-carboxylic acid?
The canonical SMILES for 3-(2,5-difluorophenyl)-1-phenylpyrazole-5-carboxylic acid is O=C(O)c1cc(-c2cc(F)ccc2F)nn1-c1ccccc1.
What is the InChIKey of 3-(2,5-difluorophenyl)-1-phenylpyrazole-5-carboxylic acid?
The InChIKey is WJJXURSXCSOYPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10F2N2O2/c17-10-6-7-13(18)12(8-10)14-9-15(16(21)22)20(19-14)11-4-2-1-3-5-11/h1-9H,(H,21,22).
What are the key properties of 3-(2,5-difluorophenyl)-1-phenylpyrazole-5-carboxylic acid?
3-(2,5-difluorophenyl)-1-phenylpyrazole-5-carboxylic acid has a molecular weight of 300.26 g/mol, XLogP of 3.52, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-difluorophenyl)-1-phenylpyrazole-5-carboxylic acid is sourced from PubChem (CID 82370998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).