C15H16O4 — CID 82372358
6-ethyl-4-(2-hydroxyethoxy)naphthalene-2-carboxylic acid (PubChem CID 82372358) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is 6-ethyl-4-(2-hydroxyethoxy)naphthalene-2-carboxylic acid.
| Compound Name | 6-ethyl-4-(2-hydroxyethoxy)naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 82372358 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 6-ethyl-4-(2-hydroxyethoxy)naphthalene-2-carboxylic acid |
| SMILES | CCc1ccc2cc(C(=O)O)cc(OCCO)c2c1 |
| InChI | InChI=1S/C15H16O4/c1-2-10-3-4-11-8-12(15(17)18)9-14(13(11)7-10)19-6-5-16/h3-4,7-9,16H,2,5-6H2,1H3,(H,17,18) |
| InChIKey | YRKLZRJUHUEAJI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |