C9H13N3O2 — CID 82373307
3,5,5-trimethyl-7,8-dihydro-4H-[1,2]oxazolo[4,3-e][1,4]diazepin-6-one (PubChem CID 82373307) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is 3,5,5-trimethyl-7,8-dihydro-4H-[1,2]oxazolo[4,3-e][1,4]diazepin-6-one.
| Compound Name | 3,5,5-trimethyl-7,8-dihydro-4H-[1,2]oxazolo[4,3-e][1,4]diazepin-6-one |
|---|---|
| PubChem CID | 82373307 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 3,5,5-trimethyl-7,8-dihydro-4H-[1,2]oxazolo[4,3-e][1,4]diazepin-6-one |
| SMILES | Cc1onc2c1NC(C)(C)C(=O)NC2 |
| InChI | InChI=1S/C9H13N3O2/c1-5-7-6(12-14-5)4-10-8(13)9(2,3)11-7/h11H,4H2,1-3H3,(H,10,13) |
| InChIKey | ZLRQYLOVQGIDLW-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |