C10H9NOS — CID 82374277
3-ethylthieno[2,3-c]pyridine-2-carbaldehyde (PubChem CID 82374277) has the molecular formula C10H9NOS and a molecular weight of 191.26 g/mol. Its IUPAC name is 3-ethylthieno[2,3-c]pyridine-2-carbaldehyde.
| Compound Name | 3-ethylthieno[2,3-c]pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 82374277 |
| Molecular Formula | C10H9NOS |
| Molecular Weight | 191.26 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | 3-ethylthieno[2,3-c]pyridine-2-carbaldehyde |
| SMILES | CCc1c(C=O)sc2cnccc12 |
| InChI | InChI=1S/C10H9NOS/c1-2-7-8-3-4-11-5-9(8)13-10(7)6-12/h3-6H,2H2,1H3 |
| InChIKey | PTSJHHAYANMGFD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|