About 4-methylthieno[2,3-d]pyrimidin-5-amine
4-methylthieno[2,3-d]pyrimidin-5-amine (PubChem CID 82375365) has the molecular formula C7H7N3S
and a molecular weight of 165.22 g/mol. Its IUPAC name is 4-methylthieno[2,3-d]pyrimidin-5-amine.
Molecular Properties
| Compound Name | 4-methylthieno[2,3-d]pyrimidin-5-amine |
| PubChem CID | 82375365 |
| Molecular Formula | C7H7N3S |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | 4-methylthieno[2,3-d]pyrimidin-5-amine |
| SMILES | Cc1ncnc2scc(N)c12 |
| InChI | InChI=1S/C7H7N3S/c1-4-6-5(8)2-11-7(6)10-3-9-4/h2-3H,8H2,1H3 |
| InChIKey | RZGCMAQNWAANRR-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methylthieno[2,3-d]pyrimidin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylthieno[2,3-d]pyrimidin-5-amine?
The IUPAC name of 4-methylthieno[2,3-d]pyrimidin-5-amine (CID 82375365) is 4-methylthieno[2,3-d]pyrimidin-5-amine.
What is the SMILES notation for 4-methylthieno[2,3-d]pyrimidin-5-amine?
The canonical SMILES for 4-methylthieno[2,3-d]pyrimidin-5-amine is Cc1ncnc2scc(N)c12.
What is the InChIKey of 4-methylthieno[2,3-d]pyrimidin-5-amine?
The InChIKey is RZGCMAQNWAANRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3S/c1-4-6-5(8)2-11-7(6)10-3-9-4/h2-3H,8H2,1H3.
What are the key properties of 4-methylthieno[2,3-d]pyrimidin-5-amine?
4-methylthieno[2,3-d]pyrimidin-5-amine has a molecular weight of 165.22 g/mol, XLogP of 1.58, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylthieno[2,3-d]pyrimidin-5-amine is sourced from PubChem (CID 82375365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).