About 4,7-dimethylpyrrolo[2,3-d]pyrimidin-5-amine
4,7-dimethylpyrrolo[2,3-d]pyrimidin-5-amine (PubChem CID 82375483) has the molecular formula C8H10N4
and a molecular weight of 162.20 g/mol. Its IUPAC name is 4,7-dimethylpyrrolo[2,3-d]pyrimidin-5-amine.
Molecular Properties
| Compound Name | 4,7-dimethylpyrrolo[2,3-d]pyrimidin-5-amine |
| PubChem CID | 82375483 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 4,7-dimethylpyrrolo[2,3-d]pyrimidin-5-amine |
| SMILES | Cc1ncnc2c1c(N)cn2C |
| InChI | InChI=1S/C8H10N4/c1-5-7-6(9)3-12(2)8(7)11-4-10-5/h3-4H,9H2,1-2H3 |
| InChIKey | MSKVOZIIPPNXMK-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,7-dimethylpyrrolo[2,3-d]pyrimidin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dimethylpyrrolo[2,3-d]pyrimidin-5-amine?
The IUPAC name of 4,7-dimethylpyrrolo[2,3-d]pyrimidin-5-amine (CID 82375483) is 4,7-dimethylpyrrolo[2,3-d]pyrimidin-5-amine.
What is the SMILES notation for 4,7-dimethylpyrrolo[2,3-d]pyrimidin-5-amine?
The canonical SMILES for 4,7-dimethylpyrrolo[2,3-d]pyrimidin-5-amine is Cc1ncnc2c1c(N)cn2C.
What is the InChIKey of 4,7-dimethylpyrrolo[2,3-d]pyrimidin-5-amine?
The InChIKey is MSKVOZIIPPNXMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4/c1-5-7-6(9)3-12(2)8(7)11-4-10-5/h3-4H,9H2,1-2H3.
What are the key properties of 4,7-dimethylpyrrolo[2,3-d]pyrimidin-5-amine?
4,7-dimethylpyrrolo[2,3-d]pyrimidin-5-amine has a molecular weight of 162.20 g/mol, XLogP of 0.86, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dimethylpyrrolo[2,3-d]pyrimidin-5-amine is sourced from PubChem (CID 82375483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).