C12H18N2S — CID 82376508
3-cyclohexyl-1,2,3,4-tetrahydrothieno[3,4-b]pyrazine (PubChem CID 82376508) has the molecular formula C12H18N2S and a molecular weight of 222.36 g/mol. Its IUPAC name is 3-cyclohexyl-1,2,3,4-tetrahydrothieno[3,4-b]pyrazine.
| Compound Name | 3-cyclohexyl-1,2,3,4-tetrahydrothieno[3,4-b]pyrazine |
|---|---|
| PubChem CID | 82376508 |
| Molecular Formula | C12H18N2S |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 3-cyclohexyl-1,2,3,4-tetrahydrothieno[3,4-b]pyrazine |
| SMILES | c1scc2c1NCC(C1CCCCC1)N2 |
| InChI | InChI=1S/C12H18N2S/c1-2-4-9(5-3-1)10-6-13-11-7-15-8-12(11)14-10/h7-10,13-14H,1-6H2 |
| InChIKey | WWNLNCHLASZIET-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |