About 2,2,4-trimethyl-3H-thieno[3,2-b][1,4]thiazine-6-carboxylic acid
2,2,4-trimethyl-3H-thieno[3,2-b][1,4]thiazine-6-carboxylic acid (PubChem CID 82376584) has the molecular formula C10H13NO2S2
and a molecular weight of 243.35 g/mol. Its IUPAC name is 2,2,4-trimethyl-3H-thieno[3,2-b][1,4]thiazine-6-carboxylic acid.
Analyze 2,2,4-trimethyl-3H-thieno[3,2-b][1,4]thiazine-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,4-trimethyl-3H-thieno[3,2-b][1,4]thiazine-6-carboxylic acid?
The IUPAC name of 2,2,4-trimethyl-3H-thieno[3,2-b][1,4]thiazine-6-carboxylic acid (CID 82376584) is 2,2,4-trimethyl-3H-thieno[3,2-b][1,4]thiazine-6-carboxylic acid.
What is the SMILES notation for 2,2,4-trimethyl-3H-thieno[3,2-b][1,4]thiazine-6-carboxylic acid?
The canonical SMILES for 2,2,4-trimethyl-3H-thieno[3,2-b][1,4]thiazine-6-carboxylic acid is CN1CC(C)(C)Sc2cc(C(=O)O)sc21.
What is the InChIKey of 2,2,4-trimethyl-3H-thieno[3,2-b][1,4]thiazine-6-carboxylic acid?
The InChIKey is PBYWCDRBSGSNEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2S2/c1-10(2)5-11(3)8-6(15-10)4-7(14-8)9(12)13/h4H,5H2,1-3H3,(H,12,13).
What are the key properties of 2,2,4-trimethyl-3H-thieno[3,2-b][1,4]thiazine-6-carboxylic acid?
2,2,4-trimethyl-3H-thieno[3,2-b][1,4]thiazine-6-carboxylic acid has a molecular weight of 243.35 g/mol, XLogP of 2.77, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,4-trimethyl-3H-thieno[3,2-b][1,4]thiazine-6-carboxylic acid is sourced from PubChem (CID 82376584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).