C13H13NOS — CID 82376755
2-benzyl-3,4-dihydro-2H-thieno[3,4-b][1,4]oxazine (PubChem CID 82376755) has the molecular formula C13H13NOS and a molecular weight of 231.32 g/mol. Its IUPAC name is 2-benzyl-3,4-dihydro-2H-thieno[3,4-b][1,4]oxazine.
| Compound Name | 2-benzyl-3,4-dihydro-2H-thieno[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 82376755 |
| Molecular Formula | C13H13NOS |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 2-benzyl-3,4-dihydro-2H-thieno[3,4-b][1,4]oxazine |
| SMILES | c1ccc(CC2CNc3cscc3O2)cc1 |
| InChI | InChI=1S/C13H13NOS/c1-2-4-10(5-3-1)6-11-7-14-12-8-16-9-13(12)15-11/h1-5,8-9,11,14H,6-7H2 |
| InChIKey | AJTTZBMCDNXNCW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |