About 1-(3-cyclopropyl-3,4-dihydro-2H-furo[2,3-b]pyrazin-1-yl)ethanone
1-(3-cyclopropyl-3,4-dihydro-2H-furo[2,3-b]pyrazin-1-yl)ethanone (PubChem CID 82377248) has the molecular formula C11H14N2O2
and a molecular weight of 206.24 g/mol. Its IUPAC name is 1-(3-cyclopropyl-3,4-dihydro-2H-furo[2,3-b]pyrazin-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(3-cyclopropyl-3,4-dihydro-2H-furo[2,3-b]pyrazin-1-yl)ethanone |
| PubChem CID | 82377248 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 1-(3-cyclopropyl-3,4-dihydro-2H-furo[2,3-b]pyrazin-1-yl)ethanone |
| SMILES | CC(=O)N1CC(C2CC2)Nc2occc21 |
| InChI | InChI=1S/C11H14N2O2/c1-7(14)13-6-9(8-2-3-8)12-11-10(13)4-5-15-11/h4-5,8-9,12H,2-3,6H2,1H3 |
| InChIKey | IPJSTERDRKSOCI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3-cyclopropyl-3,4-dihydro-2H-furo[2,3-b]pyrazin-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-cyclopropyl-3,4-dihydro-2H-furo[2,3-b]pyrazin-1-yl)ethanone?
The IUPAC name of 1-(3-cyclopropyl-3,4-dihydro-2H-furo[2,3-b]pyrazin-1-yl)ethanone (CID 82377248) is 1-(3-cyclopropyl-3,4-dihydro-2H-furo[2,3-b]pyrazin-1-yl)ethanone.
What is the SMILES notation for 1-(3-cyclopropyl-3,4-dihydro-2H-furo[2,3-b]pyrazin-1-yl)ethanone?
The canonical SMILES for 1-(3-cyclopropyl-3,4-dihydro-2H-furo[2,3-b]pyrazin-1-yl)ethanone is CC(=O)N1CC(C2CC2)Nc2occc21.
What is the InChIKey of 1-(3-cyclopropyl-3,4-dihydro-2H-furo[2,3-b]pyrazin-1-yl)ethanone?
The InChIKey is IPJSTERDRKSOCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O2/c1-7(14)13-6-9(8-2-3-8)12-11-10(13)4-5-15-11/h4-5,8-9,12H,2-3,6H2,1H3.
What are the key properties of 1-(3-cyclopropyl-3,4-dihydro-2H-furo[2,3-b]pyrazin-1-yl)ethanone?
1-(3-cyclopropyl-3,4-dihydro-2H-furo[2,3-b]pyrazin-1-yl)ethanone has a molecular weight of 206.24 g/mol, XLogP of 1.84, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-cyclopropyl-3,4-dihydro-2H-furo[2,3-b]pyrazin-1-yl)ethanone is sourced from PubChem (CID 82377248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).