C9H11NO2 — CID 82377300
2-cyclopropyl-3,4-dihydro-2H-furo[3,2-b][1,4]oxazine (PubChem CID 82377300) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is 2-cyclopropyl-3,4-dihydro-2H-furo[3,2-b][1,4]oxazine.
| Compound Name | 2-cyclopropyl-3,4-dihydro-2H-furo[3,2-b][1,4]oxazine |
|---|---|
| PubChem CID | 82377300 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 2-cyclopropyl-3,4-dihydro-2H-furo[3,2-b][1,4]oxazine |
| SMILES | c1cc2c(o1)NCC(C1CC1)O2 |
| InChI | InChI=1S/C9H11NO2/c1-2-6(1)8-5-10-9-7(12-8)3-4-11-9/h3-4,6,8,10H,1-2,5H2 |
| InChIKey | WEDPVIOHGMYUML-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |