About 3-cyclohexyl-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-4-amine
3-cyclohexyl-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-4-amine (PubChem CID 82378195) has the molecular formula C14H22N2S
and a molecular weight of 250.41 g/mol. Its IUPAC name is 3-cyclohexyl-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-4-amine.
Molecular Properties
| Compound Name | 3-cyclohexyl-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-4-amine |
| PubChem CID | 82378195 |
| Molecular Formula | C14H22N2S |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 3-cyclohexyl-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-4-amine |
| SMILES | CN1Cc2scc(C3CCCCC3)c2C(N)C1 |
| InChI | InChI=1S/C14H22N2S/c1-16-7-12(15)14-11(9-17-13(14)8-16)10-5-3-2-4-6-10/h9-10,12H,2-8,15H2,1H3 |
| InChIKey | CSCIVGMTLKYONQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cyclohexyl-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-4-amine?
The IUPAC name of 3-cyclohexyl-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-4-amine (CID 82378195) is 3-cyclohexyl-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-4-amine.
What is the SMILES notation for 3-cyclohexyl-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-4-amine?
The canonical SMILES for 3-cyclohexyl-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-4-amine is CN1Cc2scc(C3CCCCC3)c2C(N)C1.
What is the InChIKey of 3-cyclohexyl-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-4-amine?
The InChIKey is CSCIVGMTLKYONQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2S/c1-16-7-12(15)14-11(9-17-13(14)8-16)10-5-3-2-4-6-10/h9-10,12H,2-8,15H2,1H3.
What are the key properties of 3-cyclohexyl-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-4-amine?
3-cyclohexyl-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-4-amine has a molecular weight of 250.41 g/mol, XLogP of 3.24, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-4-amine is sourced from PubChem (CID 82378195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).