C14H19ClN2O — CID 82379734
N-[(1-benzylpyrrolidin-2-yl)methyl]-N-methylcarbamoyl chloride (PubChem CID 82379734) has the molecular formula C14H19ClN2O and a molecular weight of 266.77 g/mol. Its IUPAC name is N-[(1-benzylpyrrolidin-2-yl)methyl]-N-methylcarbamoyl chloride.
| Compound Name | N-[(1-benzylpyrrolidin-2-yl)methyl]-N-methylcarbamoyl chloride |
|---|---|
| PubChem CID | 82379734 |
| Molecular Formula | C14H19ClN2O |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | N-[(1-benzylpyrrolidin-2-yl)methyl]-N-methylcarbamoyl chloride |
| SMILES | CN(CC1CCCN1Cc1ccccc1)C(=O)Cl |
| InChI | InChI=1S/C14H19ClN2O/c1-16(14(15)18)11-13-8-5-9-17(13)10-12-6-3-2-4-7-12/h2-4,6-7,13H,5,8-11H2,1H3 |
| InChIKey | CAHMGSGAVNBDQD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|