C15H22N2S — CID 82380002
1-benzyl-4-thia-1,8-diazaspiro[5.5]undecane (PubChem CID 82380002) has the molecular formula C15H22N2S and a molecular weight of 262.42 g/mol. Its IUPAC name is 1-benzyl-4-thia-1,8-diazaspiro[5.5]undecane.
| Compound Name | 1-benzyl-4-thia-1,8-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 82380002 |
| Molecular Formula | C15H22N2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 1-benzyl-4-thia-1,8-diazaspiro[5.5]undecane |
| SMILES | c1ccc(CN2CCSCC23CCCNC3)cc1 |
| InChI | InChI=1S/C15H22N2S/c1-2-5-14(6-3-1)11-17-9-10-18-13-15(17)7-4-8-16-12-15/h1-3,5-6,16H,4,7-13H2 |
| InChIKey | GQTZPESQBBTHTF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |