C10H12BrNS — CID 82380390
9-bromo-2,3,4,5-tetrahydro-1-benzothiepin-7-amine (PubChem CID 82380390) has the molecular formula C10H12BrNS and a molecular weight of 258.18 g/mol. Its IUPAC name is 9-bromo-2,3,4,5-tetrahydro-1-benzothiepin-7-amine.
| Compound Name | 9-bromo-2,3,4,5-tetrahydro-1-benzothiepin-7-amine |
|---|---|
| PubChem CID | 82380390 |
| Molecular Formula | C10H12BrNS |
| Molecular Weight | 258.18 g/mol |
| Exact Mass | 256.99 |
| IUPAC Name | 9-bromo-2,3,4,5-tetrahydro-1-benzothiepin-7-amine |
| SMILES | Nc1cc(Br)c2c(c1)CCCCS2 |
| InChI | InChI=1S/C10H12BrNS/c11-9-6-8(12)5-7-3-1-2-4-13-10(7)9/h5-6H,1-4,12H2 |
| InChIKey | GPIUUASJEIPWQM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.18 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|