About 3-bromo-4-(4,4-dimethylcyclohexyl)furan
3-bromo-4-(4,4-dimethylcyclohexyl)furan (PubChem CID 82380509) has the molecular formula C12H17BrO
and a molecular weight of 257.17 g/mol. Its IUPAC name is 3-bromo-4-(4,4-dimethylcyclohexyl)furan.
Molecular Properties
| Compound Name | 3-bromo-4-(4,4-dimethylcyclohexyl)furan |
| PubChem CID | 82380509 |
| Molecular Formula | C12H17BrO |
| Molecular Weight | 257.17 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 3-bromo-4-(4,4-dimethylcyclohexyl)furan |
| SMILES | CC1(C)CCC(c2cocc2Br)CC1 |
| InChI | InChI=1S/C12H17BrO/c1-12(2)5-3-9(4-6-12)10-7-14-8-11(10)13/h7-9H,3-6H2,1-2H3 |
| InChIKey | NTWSVKRDDKOTFV-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.17 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-bromo-4-(4,4-dimethylcyclohexyl)furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4-(4,4-dimethylcyclohexyl)furan?
The IUPAC name of 3-bromo-4-(4,4-dimethylcyclohexyl)furan (CID 82380509) is 3-bromo-4-(4,4-dimethylcyclohexyl)furan.
What is the SMILES notation for 3-bromo-4-(4,4-dimethylcyclohexyl)furan?
The canonical SMILES for 3-bromo-4-(4,4-dimethylcyclohexyl)furan is CC1(C)CCC(c2cocc2Br)CC1.
What is the InChIKey of 3-bromo-4-(4,4-dimethylcyclohexyl)furan?
The InChIKey is NTWSVKRDDKOTFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17BrO/c1-12(2)5-3-9(4-6-12)10-7-14-8-11(10)13/h7-9H,3-6H2,1-2H3.
What are the key properties of 3-bromo-4-(4,4-dimethylcyclohexyl)furan?
3-bromo-4-(4,4-dimethylcyclohexyl)furan has a molecular weight of 257.17 g/mol, XLogP of 4.73, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-(4,4-dimethylcyclohexyl)furan is sourced from PubChem (CID 82380509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).