C15H18N4 — CID 82381039
2-[4-(3,6-dimethyl-1H-indol-2-yl)imidazol-1-yl]ethanamine (PubChem CID 82381039) has the molecular formula C15H18N4 and a molecular weight of 254.34 g/mol. Its IUPAC name is 2-[4-(3,6-dimethyl-1H-indol-2-yl)imidazol-1-yl]ethanamine.
| Compound Name | 2-[4-(3,6-dimethyl-1H-indol-2-yl)imidazol-1-yl]ethanamine |
|---|---|
| PubChem CID | 82381039 |
| Molecular Formula | C15H18N4 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 2-[4-(3,6-dimethyl-1H-indol-2-yl)imidazol-1-yl]ethanamine |
| SMILES | Cc1ccc2c(C)c(-c3cn(CCN)cn3)[nH]c2c1 |
| InChI | InChI=1S/C15H18N4/c1-10-3-4-12-11(2)15(18-13(12)7-10)14-8-19(6-5-16)9-17-14/h3-4,7-9,18H,5-6,16H2,1-2H3 |
| InChIKey | BYSVKPPTMSWJEL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 59.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|