About 1-methyl-2-thieno[3,2-d][1,2]thiazol-3-ylpiperidin-4-amine
1-methyl-2-thieno[3,2-d][1,2]thiazol-3-ylpiperidin-4-amine (PubChem CID 82381742) has the molecular formula C11H15N3S2
and a molecular weight of 253.40 g/mol. Its IUPAC name is 1-methyl-2-thieno[3,2-d][1,2]thiazol-3-ylpiperidin-4-amine.
Molecular Properties
| Compound Name | 1-methyl-2-thieno[3,2-d][1,2]thiazol-3-ylpiperidin-4-amine |
| PubChem CID | 82381742 |
| Molecular Formula | C11H15N3S2 |
| Molecular Weight | 253.40 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 1-methyl-2-thieno[3,2-d][1,2]thiazol-3-ylpiperidin-4-amine |
| SMILES | CN1CCC(N)CC1c1nsc2sccc12 |
| InChI | InChI=1S/C11H15N3S2/c1-14-4-2-7(12)6-9(14)10-8-3-5-15-11(8)16-13-10/h3,5,7,9H,2,4,6,12H2,1H3 |
| InChIKey | DAQSKEGMOMSUHU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-methyl-2-thieno[3,2-d][1,2]thiazol-3-ylpiperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-thieno[3,2-d][1,2]thiazol-3-ylpiperidin-4-amine?
The IUPAC name of 1-methyl-2-thieno[3,2-d][1,2]thiazol-3-ylpiperidin-4-amine (CID 82381742) is 1-methyl-2-thieno[3,2-d][1,2]thiazol-3-ylpiperidin-4-amine.
What is the SMILES notation for 1-methyl-2-thieno[3,2-d][1,2]thiazol-3-ylpiperidin-4-amine?
The canonical SMILES for 1-methyl-2-thieno[3,2-d][1,2]thiazol-3-ylpiperidin-4-amine is CN1CCC(N)CC1c1nsc2sccc12.
What is the InChIKey of 1-methyl-2-thieno[3,2-d][1,2]thiazol-3-ylpiperidin-4-amine?
The InChIKey is DAQSKEGMOMSUHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3S2/c1-14-4-2-7(12)6-9(14)10-8-3-5-15-11(8)16-13-10/h3,5,7,9H,2,4,6,12H2,1H3.
What are the key properties of 1-methyl-2-thieno[3,2-d][1,2]thiazol-3-ylpiperidin-4-amine?
1-methyl-2-thieno[3,2-d][1,2]thiazol-3-ylpiperidin-4-amine has a molecular weight of 253.40 g/mol, XLogP of 2.45, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-thieno[3,2-d][1,2]thiazol-3-ylpiperidin-4-amine is sourced from PubChem (CID 82381742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).