About 2-(2-methyl-1,3-thiazol-5-yl)thieno[3,4-d][1,3]oxazole-4-carbaldehyde
2-(2-methyl-1,3-thiazol-5-yl)thieno[3,4-d][1,3]oxazole-4-carbaldehyde (PubChem CID 82382759) has the molecular formula C10H6N2O2S2
and a molecular weight of 250.30 g/mol. Its IUPAC name is 2-(2-methyl-1,3-thiazol-5-yl)thieno[3,4-d][1,3]oxazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 2-(2-methyl-1,3-thiazol-5-yl)thieno[3,4-d][1,3]oxazole-4-carbaldehyde |
| PubChem CID | 82382759 |
| Molecular Formula | C10H6N2O2S2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 249.99 |
| IUPAC Name | 2-(2-methyl-1,3-thiazol-5-yl)thieno[3,4-d][1,3]oxazole-4-carbaldehyde |
| SMILES | Cc1ncc(-c2nc3c(C=O)scc3o2)s1 |
| InChI | InChI=1S/C10H6N2O2S2/c1-5-11-2-7(16-5)10-12-9-6(14-10)4-15-8(9)3-13/h2-4H,1H3 |
| InChIKey | IORSKRRAGLLALO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methyl-1,3-thiazol-5-yl)thieno[3,4-d][1,3]oxazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methyl-1,3-thiazol-5-yl)thieno[3,4-d][1,3]oxazole-4-carbaldehyde?
The IUPAC name of 2-(2-methyl-1,3-thiazol-5-yl)thieno[3,4-d][1,3]oxazole-4-carbaldehyde (CID 82382759) is 2-(2-methyl-1,3-thiazol-5-yl)thieno[3,4-d][1,3]oxazole-4-carbaldehyde.
What is the SMILES notation for 2-(2-methyl-1,3-thiazol-5-yl)thieno[3,4-d][1,3]oxazole-4-carbaldehyde?
The canonical SMILES for 2-(2-methyl-1,3-thiazol-5-yl)thieno[3,4-d][1,3]oxazole-4-carbaldehyde is Cc1ncc(-c2nc3c(C=O)scc3o2)s1.
What is the InChIKey of 2-(2-methyl-1,3-thiazol-5-yl)thieno[3,4-d][1,3]oxazole-4-carbaldehyde?
The InChIKey is IORSKRRAGLLALO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N2O2S2/c1-5-11-2-7(16-5)10-12-9-6(14-10)4-15-8(9)3-13/h2-4H,1H3.
What are the key properties of 2-(2-methyl-1,3-thiazol-5-yl)thieno[3,4-d][1,3]oxazole-4-carbaldehyde?
2-(2-methyl-1,3-thiazol-5-yl)thieno[3,4-d][1,3]oxazole-4-carbaldehyde has a molecular weight of 250.30 g/mol, XLogP of 3.13, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-1,3-thiazol-5-yl)thieno[3,4-d][1,3]oxazole-4-carbaldehyde is sourced from PubChem (CID 82382759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).