C13H10O6 — CID 823830
2-[(4-carboxyphenoxy)methyl]furan-3-carboxylic acid (PubChem CID 823830) has the molecular formula C13H10O6 and a molecular weight of 262.22 g/mol. Its IUPAC name is 2-[(4-carboxyphenoxy)methyl]furan-3-carboxylic acid.
| Compound Name | 2-[(4-carboxyphenoxy)methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 823830 |
| Molecular Formula | C13H10O6 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 2-[(4-carboxyphenoxy)methyl]furan-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(OCc2occc2C(=O)O)cc1 |
| InChI | InChI=1S/C13H10O6/c14-12(15)8-1-3-9(4-2-8)19-7-11-10(13(16)17)5-6-18-11/h1-6H,7H2,(H,14,15)(H,16,17) |
| InChIKey | JUSFUBIIWYZUNN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |