About 6-(1,2-benzothiazol-7-yl)-1-methylpiperidin-3-amine
6-(1,2-benzothiazol-7-yl)-1-methylpiperidin-3-amine (PubChem CID 82383689) has the molecular formula C13H17N3S
and a molecular weight of 247.37 g/mol. Its IUPAC name is 6-(1,2-benzothiazol-7-yl)-1-methylpiperidin-3-amine.
Molecular Properties
| Compound Name | 6-(1,2-benzothiazol-7-yl)-1-methylpiperidin-3-amine |
| PubChem CID | 82383689 |
| Molecular Formula | C13H17N3S |
| Molecular Weight | 247.37 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 6-(1,2-benzothiazol-7-yl)-1-methylpiperidin-3-amine |
| SMILES | CN1CC(N)CCC1c1cccc2cnsc12 |
| InChI | InChI=1S/C13H17N3S/c1-16-8-10(14)5-6-12(16)11-4-2-3-9-7-15-17-13(9)11/h2-4,7,10,12H,5-6,8,14H2,1H3 |
| InChIKey | RGMJOSAMXDQOEM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(1,2-benzothiazol-7-yl)-1-methylpiperidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1,2-benzothiazol-7-yl)-1-methylpiperidin-3-amine?
The IUPAC name of 6-(1,2-benzothiazol-7-yl)-1-methylpiperidin-3-amine (CID 82383689) is 6-(1,2-benzothiazol-7-yl)-1-methylpiperidin-3-amine.
What is the SMILES notation for 6-(1,2-benzothiazol-7-yl)-1-methylpiperidin-3-amine?
The canonical SMILES for 6-(1,2-benzothiazol-7-yl)-1-methylpiperidin-3-amine is CN1CC(N)CCC1c1cccc2cnsc12.
What is the InChIKey of 6-(1,2-benzothiazol-7-yl)-1-methylpiperidin-3-amine?
The InChIKey is RGMJOSAMXDQOEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3S/c1-16-8-10(14)5-6-12(16)11-4-2-3-9-7-15-17-13(9)11/h2-4,7,10,12H,5-6,8,14H2,1H3.
What are the key properties of 6-(1,2-benzothiazol-7-yl)-1-methylpiperidin-3-amine?
6-(1,2-benzothiazol-7-yl)-1-methylpiperidin-3-amine has a molecular weight of 247.37 g/mol, XLogP of 2.39, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,2-benzothiazol-7-yl)-1-methylpiperidin-3-amine is sourced from PubChem (CID 82383689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).