About 2-(3-methoxyimidazo[1,2-b]pyridazin-6-yl)piperidin-4-one
2-(3-methoxyimidazo[1,2-b]pyridazin-6-yl)piperidin-4-one (PubChem CID 82384508) has the molecular formula C12H14N4O2
and a molecular weight of 246.27 g/mol. Its IUPAC name is 2-(3-methoxyimidazo[1,2-b]pyridazin-6-yl)piperidin-4-one.
Molecular Properties
| Compound Name | 2-(3-methoxyimidazo[1,2-b]pyridazin-6-yl)piperidin-4-one |
| PubChem CID | 82384508 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 2-(3-methoxyimidazo[1,2-b]pyridazin-6-yl)piperidin-4-one |
| SMILES | COc1cnc2ccc(C3CC(=O)CCN3)nn12 |
| InChI | InChI=1S/C12H14N4O2/c1-18-12-7-14-11-3-2-9(15-16(11)12)10-6-8(17)4-5-13-10/h2-3,7,10,13H,4-6H2,1H3 |
| InChIKey | DTPFKYJKXNLJSS-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(3-methoxyimidazo[1,2-b]pyridazin-6-yl)piperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methoxyimidazo[1,2-b]pyridazin-6-yl)piperidin-4-one?
The IUPAC name of 2-(3-methoxyimidazo[1,2-b]pyridazin-6-yl)piperidin-4-one (CID 82384508) is 2-(3-methoxyimidazo[1,2-b]pyridazin-6-yl)piperidin-4-one.
What is the SMILES notation for 2-(3-methoxyimidazo[1,2-b]pyridazin-6-yl)piperidin-4-one?
The canonical SMILES for 2-(3-methoxyimidazo[1,2-b]pyridazin-6-yl)piperidin-4-one is COc1cnc2ccc(C3CC(=O)CCN3)nn12.
What is the InChIKey of 2-(3-methoxyimidazo[1,2-b]pyridazin-6-yl)piperidin-4-one?
The InChIKey is DTPFKYJKXNLJSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O2/c1-18-12-7-14-11-3-2-9(15-16(11)12)10-6-8(17)4-5-13-10/h2-3,7,10,13H,4-6H2,1H3.
What are the key properties of 2-(3-methoxyimidazo[1,2-b]pyridazin-6-yl)piperidin-4-one?
2-(3-methoxyimidazo[1,2-b]pyridazin-6-yl)piperidin-4-one has a molecular weight of 246.27 g/mol, XLogP of 0.73, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methoxyimidazo[1,2-b]pyridazin-6-yl)piperidin-4-one is sourced from PubChem (CID 82384508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).