C15H21N3 — CID 82386113
(6-ethyl-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)methanamine (PubChem CID 82386113) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is (6-ethyl-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)methanamine.
| Compound Name | (6-ethyl-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)methanamine |
|---|---|
| PubChem CID | 82386113 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | (6-ethyl-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)methanamine |
| SMILES | CCc1ccc2[nH]c3c(c2c1)CCN(C)C3CN |
| InChI | InChI=1S/C15H21N3/c1-3-10-4-5-13-12(8-10)11-6-7-18(2)14(9-16)15(11)17-13/h4-5,8,14,17H,3,6-7,9,16H2,1-2H3 |
| InChIKey | GMFKTNHKYVISRH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|