About 5-ethyl-4-(1H-pyrrolo[2,3-c]pyridin-5-yl)thiophen-2-amine
5-ethyl-4-(1H-pyrrolo[2,3-c]pyridin-5-yl)thiophen-2-amine (PubChem CID 82386183) has the molecular formula C13H13N3S
and a molecular weight of 243.34 g/mol. Its IUPAC name is 5-ethyl-4-(1H-pyrrolo[2,3-c]pyridin-5-yl)thiophen-2-amine.
Molecular Properties
| Compound Name | 5-ethyl-4-(1H-pyrrolo[2,3-c]pyridin-5-yl)thiophen-2-amine |
| PubChem CID | 82386183 |
| Molecular Formula | C13H13N3S |
| Molecular Weight | 243.34 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 5-ethyl-4-(1H-pyrrolo[2,3-c]pyridin-5-yl)thiophen-2-amine |
| SMILES | CCc1sc(N)cc1-c1cc2cc[nH]c2cn1 |
| InChI | InChI=1S/C13H13N3S/c1-2-12-9(6-13(14)17-12)10-5-8-3-4-15-11(8)7-16-10/h3-7,15H,2,14H2,1H3 |
| InChIKey | IYBUFQKJSAPTKI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethyl-4-(1H-pyrrolo[2,3-c]pyridin-5-yl)thiophen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-4-(1H-pyrrolo[2,3-c]pyridin-5-yl)thiophen-2-amine?
The IUPAC name of 5-ethyl-4-(1H-pyrrolo[2,3-c]pyridin-5-yl)thiophen-2-amine (CID 82386183) is 5-ethyl-4-(1H-pyrrolo[2,3-c]pyridin-5-yl)thiophen-2-amine.
What is the SMILES notation for 5-ethyl-4-(1H-pyrrolo[2,3-c]pyridin-5-yl)thiophen-2-amine?
The canonical SMILES for 5-ethyl-4-(1H-pyrrolo[2,3-c]pyridin-5-yl)thiophen-2-amine is CCc1sc(N)cc1-c1cc2cc[nH]c2cn1.
What is the InChIKey of 5-ethyl-4-(1H-pyrrolo[2,3-c]pyridin-5-yl)thiophen-2-amine?
The InChIKey is IYBUFQKJSAPTKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3S/c1-2-12-9(6-13(14)17-12)10-5-8-3-4-15-11(8)7-16-10/h3-7,15H,2,14H2,1H3.
What are the key properties of 5-ethyl-4-(1H-pyrrolo[2,3-c]pyridin-5-yl)thiophen-2-amine?
5-ethyl-4-(1H-pyrrolo[2,3-c]pyridin-5-yl)thiophen-2-amine has a molecular weight of 243.34 g/mol, XLogP of 3.44, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-4-(1H-pyrrolo[2,3-c]pyridin-5-yl)thiophen-2-amine is sourced from PubChem (CID 82386183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).