About 5-(2-methyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyridine-2-carbaldehyde
5-(2-methyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyridine-2-carbaldehyde (PubChem CID 82386342) has the molecular formula C12H9N3OS
and a molecular weight of 243.29 g/mol. Its IUPAC name is 5-(2-methyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyridine-2-carbaldehyde.
Molecular Properties
| Compound Name | 5-(2-methyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyridine-2-carbaldehyde |
| PubChem CID | 82386342 |
| Molecular Formula | C12H9N3OS |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 5-(2-methyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyridine-2-carbaldehyde |
| SMILES | Cc1ncc(-c2cccc3nc(C=O)cn23)s1 |
| InChI | InChI=1S/C12H9N3OS/c1-8-13-5-11(17-8)10-3-2-4-12-14-9(7-16)6-15(10)12/h2-7H,1H3 |
| InChIKey | NEVAQCVFMNUZHK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-methyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyridine-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-methyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyridine-2-carbaldehyde?
The IUPAC name of 5-(2-methyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyridine-2-carbaldehyde (CID 82386342) is 5-(2-methyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyridine-2-carbaldehyde.
What is the SMILES notation for 5-(2-methyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyridine-2-carbaldehyde?
The canonical SMILES for 5-(2-methyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyridine-2-carbaldehyde is Cc1ncc(-c2cccc3nc(C=O)cn23)s1.
What is the InChIKey of 5-(2-methyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyridine-2-carbaldehyde?
The InChIKey is NEVAQCVFMNUZHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3OS/c1-8-13-5-11(17-8)10-3-2-4-12-14-9(7-16)6-15(10)12/h2-7H,1H3.
What are the key properties of 5-(2-methyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyridine-2-carbaldehyde?
5-(2-methyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyridine-2-carbaldehyde has a molecular weight of 243.29 g/mol, XLogP of 2.58, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyridine-2-carbaldehyde is sourced from PubChem (CID 82386342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).