About 2-(1H-indol-5-yl)-1-(3-methyl-1,2-oxazol-4-yl)ethanamine
2-(1H-indol-5-yl)-1-(3-methyl-1,2-oxazol-4-yl)ethanamine (PubChem CID 82387429) has the molecular formula C14H15N3O
and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-(1H-indol-5-yl)-1-(3-methyl-1,2-oxazol-4-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(1H-indol-5-yl)-1-(3-methyl-1,2-oxazol-4-yl)ethanamine |
| PubChem CID | 82387429 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 2-(1H-indol-5-yl)-1-(3-methyl-1,2-oxazol-4-yl)ethanamine |
| SMILES | Cc1nocc1C(N)Cc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C14H15N3O/c1-9-12(8-18-17-9)13(15)7-10-2-3-14-11(6-10)4-5-16-14/h2-6,8,13,16H,7,15H2,1H3 |
| InChIKey | QAVMAQSJMAKRPY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1H-indol-5-yl)-1-(3-methyl-1,2-oxazol-4-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-indol-5-yl)-1-(3-methyl-1,2-oxazol-4-yl)ethanamine?
The IUPAC name of 2-(1H-indol-5-yl)-1-(3-methyl-1,2-oxazol-4-yl)ethanamine (CID 82387429) is 2-(1H-indol-5-yl)-1-(3-methyl-1,2-oxazol-4-yl)ethanamine.
What is the SMILES notation for 2-(1H-indol-5-yl)-1-(3-methyl-1,2-oxazol-4-yl)ethanamine?
The canonical SMILES for 2-(1H-indol-5-yl)-1-(3-methyl-1,2-oxazol-4-yl)ethanamine is Cc1nocc1C(N)Cc1ccc2[nH]ccc2c1.
What is the InChIKey of 2-(1H-indol-5-yl)-1-(3-methyl-1,2-oxazol-4-yl)ethanamine?
The InChIKey is QAVMAQSJMAKRPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O/c1-9-12(8-18-17-9)13(15)7-10-2-3-14-11(6-10)4-5-16-14/h2-6,8,13,16H,7,15H2,1H3.
What are the key properties of 2-(1H-indol-5-yl)-1-(3-methyl-1,2-oxazol-4-yl)ethanamine?
2-(1H-indol-5-yl)-1-(3-methyl-1,2-oxazol-4-yl)ethanamine has a molecular weight of 241.29 g/mol, XLogP of 2.71, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-indol-5-yl)-1-(3-methyl-1,2-oxazol-4-yl)ethanamine is sourced from PubChem (CID 82387429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).