About 1-methyl-2-thieno[2,3-d][1,3]dioxol-5-ylpiperidin-4-amine
1-methyl-2-thieno[2,3-d][1,3]dioxol-5-ylpiperidin-4-amine (PubChem CID 82387787) has the molecular formula C11H16N2O2S
and a molecular weight of 240.33 g/mol. Its IUPAC name is 1-methyl-2-thieno[2,3-d][1,3]dioxol-5-ylpiperidin-4-amine.
Molecular Properties
| Compound Name | 1-methyl-2-thieno[2,3-d][1,3]dioxol-5-ylpiperidin-4-amine |
| PubChem CID | 82387787 |
| Molecular Formula | C11H16N2O2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 1-methyl-2-thieno[2,3-d][1,3]dioxol-5-ylpiperidin-4-amine |
| SMILES | CN1CCC(N)CC1c1cc2c(s1)OCO2 |
| InChI | InChI=1S/C11H16N2O2S/c1-13-3-2-7(12)4-8(13)10-5-9-11(16-10)15-6-14-9/h5,7-8H,2-4,6,12H2,1H3 |
| InChIKey | IBGVRJFHPXLQRT-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-methyl-2-thieno[2,3-d][1,3]dioxol-5-ylpiperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-thieno[2,3-d][1,3]dioxol-5-ylpiperidin-4-amine?
The IUPAC name of 1-methyl-2-thieno[2,3-d][1,3]dioxol-5-ylpiperidin-4-amine (CID 82387787) is 1-methyl-2-thieno[2,3-d][1,3]dioxol-5-ylpiperidin-4-amine.
What is the SMILES notation for 1-methyl-2-thieno[2,3-d][1,3]dioxol-5-ylpiperidin-4-amine?
The canonical SMILES for 1-methyl-2-thieno[2,3-d][1,3]dioxol-5-ylpiperidin-4-amine is CN1CCC(N)CC1c1cc2c(s1)OCO2.
What is the InChIKey of 1-methyl-2-thieno[2,3-d][1,3]dioxol-5-ylpiperidin-4-amine?
The InChIKey is IBGVRJFHPXLQRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O2S/c1-13-3-2-7(12)4-8(13)10-5-9-11(16-10)15-6-14-9/h5,7-8H,2-4,6,12H2,1H3.
What are the key properties of 1-methyl-2-thieno[2,3-d][1,3]dioxol-5-ylpiperidin-4-amine?
1-methyl-2-thieno[2,3-d][1,3]dioxol-5-ylpiperidin-4-amine has a molecular weight of 240.33 g/mol, XLogP of 1.57, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-thieno[2,3-d][1,3]dioxol-5-ylpiperidin-4-amine is sourced from PubChem (CID 82387787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).