About 3-thieno[3,2-d][1,2]thiazol-5-ylpiperidin-4-one
3-thieno[3,2-d][1,2]thiazol-5-ylpiperidin-4-one (PubChem CID 82388620) has the molecular formula C10H10N2OS2
and a molecular weight of 238.34 g/mol. Its IUPAC name is 3-thieno[3,2-d][1,2]thiazol-5-ylpiperidin-4-one.
Molecular Properties
| Compound Name | 3-thieno[3,2-d][1,2]thiazol-5-ylpiperidin-4-one |
| PubChem CID | 82388620 |
| Molecular Formula | C10H10N2OS2 |
| Molecular Weight | 238.34 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | 3-thieno[3,2-d][1,2]thiazol-5-ylpiperidin-4-one |
| SMILES | O=C1CCNCC1c1cc2cnsc2s1 |
| InChI | InChI=1S/C10H10N2OS2/c13-8-1-2-11-5-7(8)9-3-6-4-12-15-10(6)14-9/h3-4,7,11H,1-2,5H2 |
| InChIKey | NIWOITFXVSIPHA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-thieno[3,2-d][1,2]thiazol-5-ylpiperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-thieno[3,2-d][1,2]thiazol-5-ylpiperidin-4-one?
The IUPAC name of 3-thieno[3,2-d][1,2]thiazol-5-ylpiperidin-4-one (CID 82388620) is 3-thieno[3,2-d][1,2]thiazol-5-ylpiperidin-4-one.
What is the SMILES notation for 3-thieno[3,2-d][1,2]thiazol-5-ylpiperidin-4-one?
The canonical SMILES for 3-thieno[3,2-d][1,2]thiazol-5-ylpiperidin-4-one is O=C1CCNCC1c1cc2cnsc2s1.
What is the InChIKey of 3-thieno[3,2-d][1,2]thiazol-5-ylpiperidin-4-one?
The InChIKey is NIWOITFXVSIPHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2OS2/c13-8-1-2-11-5-7(8)9-3-6-4-12-15-10(6)14-9/h3-4,7,11H,1-2,5H2.
What are the key properties of 3-thieno[3,2-d][1,2]thiazol-5-ylpiperidin-4-one?
3-thieno[3,2-d][1,2]thiazol-5-ylpiperidin-4-one has a molecular weight of 238.34 g/mol, XLogP of 2.00, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-thieno[3,2-d][1,2]thiazol-5-ylpiperidin-4-one is sourced from PubChem (CID 82388620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).